CAS 116476-70-1 is the registry number for N,N'-Bis(3-methylphenyl)propanediamide. Offered by: TRC. Available pack sizes: 1g, 2,5g, 5g.
N,N'-bis(3-methylphenyl)propanediamide (CAS 116476-70-1) is a chemical compound with the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. IUPAC name: N,N'-bis(3-methylphenyl)propanediamide. InChIKey: HJYKPTPEJZYMGZ-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O2 |
|---|---|
| Molecular weight | 282.34 g/mol |
| IUPAC name | N,N'-bis(3-methylphenyl)propanediamide |
| InChIKey | HJYKPTPEJZYMGZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NC(=O)CC(=O)NC2=CC=CC(=C2)C |
Computed by PubChem (NCBI)