CAS 116477-30-6 appears in our catalog under these names: 4,6-Dichloro-2,5-Diformamidopyrimidine, >95% (HPLC), 4,6-Dichloro-2,5-diformamidopyrimidine. Offered by: TRC, Mikromol. Available pack sizes: 250mg, 500mg, 50mg, 25mg.
N-(4,6-dichloro-2-formamidopyrimidin-5-yl)formamide (CAS 116477-30-6) is a chemical compound with the molecular formula C6H4Cl2N4O2 and a molecular weight of 235.02 g/mol. IUPAC name: N-(4,6-dichloro-2-formamidopyrimidin-5-yl)formamide. InChIKey: SJUZRTBKERGCTK-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N4O2 |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | N-(4,6-dichloro-2-formamidopyrimidin-5-yl)formamide |
| InChIKey | SJUZRTBKERGCTK-UHFFFAOYSA-N |
| SMILES | C(=O)NC1=C(N=C(N=C1Cl)NC=O)Cl |
Computed by PubChem (NCBI)