Products 116515-48-1

CAS 116515-48-1 appears in our catalog under these names: 2,3-Dihydro-1H-pyrrolizine-7-carboxylic acid, 2,3-Dihydro-1H-pyrrolizine-7-carboxylic acid, 95%, 95%, 2,3-Dihydro-1H-pyrrolizine-7-carboxylic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

6,7-dihydro-5H-pyrrolizine-1-carboxylic acid (CAS 116515-48-1) is a chemical compound with the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. IUPAC name: 6,7-dihydro-5H-pyrrolizine-1-carboxylic acid. InChIKey: CYYLHKZGLFLYPE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9NO2
Molecular weight151.16 g/mol
IUPAC name6,7-dihydro-5H-pyrrolizine-1-carboxylic acid
InChIKeyCYYLHKZGLFLYPE-UHFFFAOYSA-N
SMILESC1CC2=C(C=CN2C1)C(=O)O

Computed by PubChem (NCBI)