CAS 116535-65-0 is the registry number for Calcitriol Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,3aR,4S,7aR)-1-[(2S)-1-iodopropan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (CAS 116535-65-0) is a chemical compound with the molecular formula C13H23IO and a molecular weight of 322.23 g/mol. IUPAC name: (1R,3aR,4S,7aR)-1-[(2S)-1-iodopropan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol. InChIKey: UPOCHUQWLLGPLP-NAWOPXAZSA-N.
| Molecular formula | C13H23IO |
|---|---|
| Molecular weight | 322.23 g/mol |
| IUPAC name | (1R,3aR,4S,7aR)-1-[(2S)-1-iodopropan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| InChIKey | UPOCHUQWLLGPLP-NAWOPXAZSA-N |
| SMILES | C[C@H](CI)[C@H]1CC[C@@H]2[C@@]1(CCC[C@@H]2O)C |
Computed by PubChem (NCBI)