Products 116540-88-6
CAS 116540-88-6 appears in our catalog under these names: 3-Chloro-6,6a-dihydro-1aH-indeno(1,2-b)oxirene, 95+%, 3-Chloro-1aH,6H,6aH-indeno(1,2-b)oxirene. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-chloro-6,6a-dihydro-1aH-indeno[1,2-b]oxirene (CAS 116540-88-6) is a chemical compound with the molecular formula C9H7ClO and a molecular weight of 166.60 g/mol. IUPAC name: 3-chloro-6,6a-dihydro-1aH-indeno[1,2-b]oxirene. InChIKey: FXFBGEDPBBRUFN-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO |
|---|---|
| Molecular weight | 166.60 g/mol |
| IUPAC name | 3-chloro-6,6a-dihydro-1aH-indeno[1,2-b]oxirene |
| InChIKey | FXFBGEDPBBRUFN-UHFFFAOYSA-N |
| SMILES | C1C2C(O2)C3=C1C=CC(=C3)Cl |
Computed by PubChem (NCBI)