CAS 1165910-22-4 appears in our catalog under these names: LGD-4033, 98%, LGD-4033, >95% (HPLC), Ligandrol, LGD–4033, LGD-4033. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 250mg, 5g, 1g, 10mg, 25mg, 50mg, 100mg, 200mg.
4-[(2R)-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]-2-(trifluoromethyl)benzonitrile (CAS 1165910-22-4) is a chemical compound with the molecular formula C14H12F6N2O and a molecular weight of 338.25 g/mol. IUPAC name: 4-[(2R)-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]-2-(trifluoromethyl)benzonitrile. InChIKey: OPSIVAKKLQRWKC-VXGBXAGGSA-N.
| Molecular formula | C14H12F6N2O |
|---|---|
| Molecular weight | 338.25 g/mol |
| IUPAC name | 4-[(2R)-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| InChIKey | OPSIVAKKLQRWKC-VXGBXAGGSA-N |
| SMILES | C1C[C@@H](N(C1)C2=CC(=C(C=C2)C#N)C(F)(F)F)[C@H](C(F)(F)F)O |
Computed by PubChem (NCBI)