CAS 116610-63-0 is the registry number for 2-(2-Bromophenyl)-4-methylsulfanyl-6-phenylpyridine. Offered by: TRC. Available pack sizes: 1g.
2-(2-bromophenyl)-4-methylsulfanyl-6-phenylpyridine (CAS 116610-63-0) is a chemical compound with the molecular formula C18H14BrNS and a molecular weight of 356.3 g/mol. IUPAC name: 2-(2-bromophenyl)-4-methylsulfanyl-6-phenylpyridine. InChIKey: NSSVNTAZBLPJHD-UHFFFAOYSA-N.
| Molecular formula | C18H14BrNS |
|---|---|
| Molecular weight | 356.3 g/mol |
| IUPAC name | 2-(2-bromophenyl)-4-methylsulfanyl-6-phenylpyridine |
| InChIKey | NSSVNTAZBLPJHD-UHFFFAOYSA-N |
| SMILES | CSC1=CC(=NC(=C1)C2=CC=CC=C2Br)C3=CC=CC=C3 |
Computed by PubChem (NCBI)