CAS 116617-31-3 is the registry number for 2-[Cyano(4-fluorophenyl)methyl]benzonitrile, 95%. Offered by: Fluorochem. Available pack sizes: 500mg, 1g.
2-[cyano-(4-fluorophenyl)methyl]benzonitrile (CAS 116617-31-3) is a chemical compound with the molecular formula C15H9FN2 and a molecular weight of 236.24 g/mol. IUPAC name: 2-[cyano-(4-fluorophenyl)methyl]benzonitrile. InChIKey: BRHKEEJUFXPRIJ-UHFFFAOYSA-N.
| Molecular formula | C15H9FN2 |
|---|---|
| Molecular weight | 236.24 g/mol |
| IUPAC name | 2-[cyano-(4-fluorophenyl)methyl]benzonitrile |
| InChIKey | BRHKEEJUFXPRIJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)C(C#N)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)