CAS 116622-38-9 appears in our catalog under these names: (S)-2-Amino-4-cyclohexyl butanoic acid, 97%, (S)–2–Amino–4–cyclohexylbutanoic acid, H-HoCyclohexyl-Ala-OH 97%, (S)-2-Amino-4-cyclohexylbutanoic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 100mg, 250mg, 100g.
(2S)-2-amino-4-cyclohexylbutanoic acid (CAS 116622-38-9) is a chemical compound with the molecular formula C10H19NO2 and a molecular weight of 185.26 g/mol. IUPAC name: (2S)-2-amino-4-cyclohexylbutanoic acid. InChIKey: MXHKOHWUQAULOV-VIFPVBQESA-N.
| Molecular formula | C10H19NO2 |
|---|---|
| Molecular weight | 185.26 g/mol |
| IUPAC name | (2S)-2-amino-4-cyclohexylbutanoic acid |
| InChIKey | MXHKOHWUQAULOV-VIFPVBQESA-N |
| SMILES | C1CCC(CC1)CC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)