Products 1166398-85-1
CAS 1166398-85-1 is the registry number for Radamide. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl 3-chloro-2-[2-(2,5-dihydroxy-4-methoxyanilino)-2-oxoethyl]-4,6-dihydroxybenzoate (CAS 1166398-85-1) is a chemical compound with the molecular formula C18H18ClNO8 and a molecular weight of 411.8 g/mol. IUPAC name: ethyl 3-chloro-2-[2-(2,5-dihydroxy-4-methoxyanilino)-2-oxoethyl]-4,6-dihydroxybenzoate. InChIKey: RULSXWFZXUOCOD-UHFFFAOYSA-N.
| Molecular formula | C18H18ClNO8 |
|---|---|
| Molecular weight | 411.8 g/mol |
| IUPAC name | ethyl 3-chloro-2-[2-(2,5-dihydroxy-4-methoxyanilino)-2-oxoethyl]-4,6-dihydroxybenzoate |
| InChIKey | RULSXWFZXUOCOD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(C=C1O)O)Cl)CC(=O)NC2=CC(=C(C=C2O)OC)O |
Computed by PubChem (NCBI)
Synonyms:
Radamide, orb1702884