Products 116673-45-1
CAS 116673-45-1 appears in our catalog under these names: (±)trans–2,5–bis–(3,4,5–Trimethoxyphenyl)–1,3–dioxolane, rel-(2R,4R)-2,4-Bis(3,4,5-trimethoxyphenyl)-1,3-dioxolane. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 5 mg, 10 mg, 1 mg.
(2R,4R)-2,4-bis(3,4,5-trimethoxyphenyl)-1,3-dioxolane (CAS 116673-45-1) is a chemical compound with the molecular formula C21H26O8 and a molecular weight of 406.4 g/mol. IUPAC name: (2R,4R)-2,4-bis(3,4,5-trimethoxyphenyl)-1,3-dioxolane. InChIKey: DUAYHYGJMLZLCE-GHTZIAJQSA-N.
| Molecular formula | C21H26O8 |
|---|---|
| Molecular weight | 406.4 g/mol |
| IUPAC name | (2R,4R)-2,4-bis(3,4,5-trimethoxyphenyl)-1,3-dioxolane |
| InChIKey | DUAYHYGJMLZLCE-GHTZIAJQSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)[C@@H]2CO[C@H](O2)C3=CC(=C(C(=C3)OC)OC)OC |
Computed by PubChem (NCBI)