CAS 1166820-46-7 appears in our catalog under these names: 1-Bromo-2-difluoromethyl-3-fluorobenzene, 95%, 1-Bromo-2-difluoromethyl-3-fluorobenzene, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-bromo-2-(difluoromethyl)-3-fluorobenzene (CAS 1166820-46-7) is a chemical compound with the molecular formula C7H4BrF3 and a molecular weight of 225.01 g/mol. IUPAC name: 1-bromo-2-(difluoromethyl)-3-fluorobenzene. InChIKey: CRUJWSKZSKRRLV-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3 |
|---|---|
| Molecular weight | 225.01 g/mol |
| IUPAC name | 1-bromo-2-(difluoromethyl)-3-fluorobenzene |
| InChIKey | CRUJWSKZSKRRLV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C(F)F)F |
Computed by PubChem (NCBI)