CAS 1166838-84-1 appears in our catalog under these names: Sphingosine–1–Phosphate Lyase Fluorogenic Substrate, S1P Lyase Fluorogenic Substrate, SGPL1 fluorogenic substrate, 98.81%. Offered by: GLPBio, TRC, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 50mg, 1 mg, 500 μg.
[(2S,3R)-2-amino-3-hydroxy-5-(2-oxochromen-7-yl)oxypentyl] dihydrogen phosphate (CAS 1166838-84-1) is a chemical compound with the molecular formula C14H18NO8P and a molecular weight of 359.27 g/mol. IUPAC name: [(2S,3R)-2-amino-3-hydroxy-5-(2-oxochromen-7-yl)oxypentyl] dihydrogen phosphate. InChIKey: XHAKPJBOPPIZOR-NWDGAFQWSA-N.
| Molecular formula | C14H18NO8P |
|---|---|
| Molecular weight | 359.27 g/mol |
| IUPAC name | [(2S,3R)-2-amino-3-hydroxy-5-(2-oxochromen-7-yl)oxypentyl] dihydrogen phosphate |
| InChIKey | XHAKPJBOPPIZOR-NWDGAFQWSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=O)O2)OCC[C@H]([C@H](COP(=O)(O)O)N)O |
Computed by PubChem (NCBI)