CAS 116700-36-8 appears in our catalog under these names: Fasudil Impurity 23 DiHCl, H-9 2HCl, 97%, H-9 dihydrochloride/ 96.57% (existing batch purity), H–9 dihydrochloride, N-(2-Aminoethyl)isoquinoline-5-sulfonamide dihydrochloride, 97%, 97%. Offered by: Chemat Brand, AmBeed, TargetMol, GLPBio, Chemat. Available pack sizes: on request, 1g, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg.
N-(2-aminoethyl)isoquinoline-5-sulfonamide;dihydrochloride (CAS 116700-36-8) is a chemical compound with the molecular formula C11H15Cl2N3O2S and a molecular weight of 324.2 g/mol. IUPAC name: N-(2-aminoethyl)isoquinoline-5-sulfonamide;dihydrochloride. InChIKey: HBLCYSFLYMHCBM-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2N3O2S |
|---|---|
| Molecular weight | 324.2 g/mol |
| IUPAC name | N-(2-aminoethyl)isoquinoline-5-sulfonamide;dihydrochloride |
| InChIKey | HBLCYSFLYMHCBM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2)C(=C1)S(=O)(=O)NCCN.Cl.Cl |
Computed by PubChem (NCBI)