CAS 1167435-22-4 is the registry number for 2,3,4,5-Tetrahydro-7-methoxy-4-(methyl-d3)-1,4-benzothiazepine. Offered by: TRC. Available pack sizes: 100mg.
7-methoxy-4-(trideuteriomethyl)-3,5-dihydro-2H-1,4-benzothiazepine (CAS 1167435-22-4) is a chemical compound with the molecular formula C11H15NOS and a molecular weight of 212.33 g/mol. IUPAC name: 7-methoxy-4-(trideuteriomethyl)-3,5-dihydro-2H-1,4-benzothiazepine. InChIKey: BGVCEGVSQDOGSB-FIBGUPNXSA-N.
| Molecular formula | C11H15NOS |
|---|---|
| Molecular weight | 212.33 g/mol |
| IUPAC name | 7-methoxy-4-(trideuteriomethyl)-3,5-dihydro-2H-1,4-benzothiazepine |
| InChIKey | BGVCEGVSQDOGSB-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1CCSC2=C(C1)C=C(C=C2)OC |
Computed by PubChem (NCBI)