Products 116757-85-8
CAS 116757-85-8 is the registry number for 2,2,2-Trifluoro-1-(1H-indol-3-yl)ethan-1-ol. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2,2,2-trifluoro-1-(1H-indol-3-yl)ethanol (CAS 116757-85-8) is a chemical compound with the molecular formula C10H8F3NO and a molecular weight of 215.17 g/mol. IUPAC name: 2,2,2-trifluoro-1-(1H-indol-3-yl)ethanol. InChIKey: OJLPWVOWEHJINA-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO |
|---|---|
| Molecular weight | 215.17 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(1H-indol-3-yl)ethanol |
| InChIKey | OJLPWVOWEHJINA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(C(F)(F)F)O |
Computed by PubChem (NCBI)