CAS 116763-36-1 is the registry number for Nestifylline. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-(1,3-dithiolan-2-ylmethyl)-1,3-dimethylpurine-2,6-dione (CAS 116763-36-1) is a chemical compound with the molecular formula C11H14N4O2S2 and a molecular weight of 298.4 g/mol. IUPAC name: 7-(1,3-dithiolan-2-ylmethyl)-1,3-dimethylpurine-2,6-dione. InChIKey: HIQUBRAKVZRBRW-UHFFFAOYSA-N.
| Molecular formula | C11H14N4O2S2 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | 7-(1,3-dithiolan-2-ylmethyl)-1,3-dimethylpurine-2,6-dione |
| InChIKey | HIQUBRAKVZRBRW-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CC3SCCS3 |
Computed by PubChem (NCBI)