CAS 1167991-21-0 appears in our catalog under these names: 3,6-Dihydro-2h-pyridine-1-n-boc-4-boronic acid neopentylglycol ester, 97%, tert-Butyl 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-5,6-dihydropyridine-1(2H)-carboxylate, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 25g, 1g, 100mg, 250mg.
Tert-butyl 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate (CAS 1167991-21-0) is a chemical compound with the molecular formula C15H26BNO4 and a molecular weight of 295.18 g/mol. IUPAC name: tert-butyl 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate. InChIKey: UFNYQCSGFXGPFD-UHFFFAOYSA-N.
| Molecular formula | C15H26BNO4 |
|---|---|
| Molecular weight | 295.18 g/mol |
| IUPAC name | tert-butyl 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| InChIKey | UFNYQCSGFXGPFD-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)