CAS 1168139-52-3 appears in our catalog under these names: (R)–1–(3–Chlorophenyl)propan–1–amine, (R)-1-(3-Chlorophenyl)propan-1-amine 95%, (R)-1-(3-Chlorophenyl)propan-1-amine, 97%, (R)-1-(3-Chlorophenyl)propan-1-amine hydrochloride, 95%, (R)-1-(3-Chlorophenyl)propan-1-amine, 95%, 95%. Offered by: GLPBio, Ambeed, Fluorochem, Combi-blocks, Chemat. Available pack sizes: 1g, 100mg, 250mg.
(1R)-1-(3-chlorophenyl)propan-1-amine (CAS 1168139-52-3) is a chemical compound with the molecular formula C9H12ClN and a molecular weight of 169.65 g/mol. IUPAC name: (1R)-1-(3-chlorophenyl)propan-1-amine. InChIKey: PLIWCUPYMOIFAV-SECBINFHSA-N.
| Molecular formula | C9H12ClN |
|---|---|
| Molecular weight | 169.65 g/mol |
| IUPAC name | (1R)-1-(3-chlorophenyl)propan-1-amine |
| InChIKey | PLIWCUPYMOIFAV-SECBINFHSA-N |
| SMILES | CC[C@H](C1=CC(=CC=C1)Cl)N |
Computed by PubChem (NCBI)