Products 116833-23-9

CAS 116833-23-9 is the registry number for Sildenafil Impurity 78. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-methylpiperazine-1-sulfonic acid (CAS 116833-23-9) is a chemical compound with the molecular formula C5H12N2O3S and a molecular weight of 180.23 g/mol. IUPAC name: 4-methylpiperazine-1-sulfonic acid. InChIKey: GQPIVVPQPRWBML-UHFFFAOYSA-N.

Identity
Molecular formulaC5H12N2O3S
Molecular weight180.23 g/mol
IUPAC name4-methylpiperazine-1-sulfonic acid
InChIKeyGQPIVVPQPRWBML-UHFFFAOYSA-N
SMILESCN1CCN(CC1)S(=O)(=O)O

Computed by PubChem (NCBI)