CAS 116939-85-6 appears in our catalog under these names: Boc-Met-Pro-OH, Boc–Met–Pro–OH. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 10g, 25g.
(2S)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]pyrrolidine-2-carboxylic acid (CAS 116939-85-6) is a chemical compound with the molecular formula C15H26N2O5S and a molecular weight of 346.4 g/mol. IUPAC name: (2S)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]pyrrolidine-2-carboxylic acid. InChIKey: GYLAFPKEPIVJKM-QWRGUYRKSA-N.
| Molecular formula | C15H26N2O5S |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | (2S)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | GYLAFPKEPIVJKM-QWRGUYRKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCSC)C(=O)N1CCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)