CAS 116941-51-6 appears in our catalog under these names: 4-Chloro-5'-phenyl-1,1':3',1''-terphenyl, 95%, 4-Chloro-5'-phenyl-1,1':3',1''-terphenyl, 98%, 4–Chloro–5'–phenyl–1,1':3',1''–terphenyl, 4-Chloro-5'-phenyl-1,1':3',1''-terphenyl, >98.0%(GC), 4-Chloro-5'-phenyl-1,1':3',1''-terphenyl, 98.0%, 98.0%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 200mg, 1g, 250mg, 25g.
1-(4-chlorophenyl)-3,5-diphenylbenzene (CAS 116941-51-6) is a chemical compound with the molecular formula C24H17Cl and a molecular weight of 340.8 g/mol. IUPAC name: 1-(4-chlorophenyl)-3,5-diphenylbenzene. InChIKey: FZOIFXXPBLTVIG-UHFFFAOYSA-N.
| Molecular formula | C24H17Cl |
|---|---|
| Molecular weight | 340.8 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3,5-diphenylbenzene |
| InChIKey | FZOIFXXPBLTVIG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)C3=CC=C(C=C3)Cl)C4=CC=CC=C4 |
Computed by PubChem (NCBI)