Products 1169764-58-2
CAS 1169764-58-2 appears in our catalog under these names: Linoleic acid–d5, Linoleic acid-d5, 99.77%, Linoleic acid (D5), Linoleic acid-d5, ≥98%,≥99 atom% D. Offered by: GLPBio, MedChemExpress, Sigma-Aldrich, Chemat. Available pack sizes: 500μg（35,03mM * 50μl in ethanol）, 500 μg (35.03 mM * 50 μL in Ethanol), 1MG, 10MG.
(9E,12E)-17,17,18,18,18-pentadeuteriooctadeca-9,12-dienoic acid (CAS 1169764-58-2) is a chemical compound with the molecular formula C18H32O2 and a molecular weight of 285.5 g/mol. IUPAC name: (9E,12E)-17,17,18,18,18-pentadeuteriooctadeca-9,12-dienoic acid. InChIKey: OYHQOLUKZRVURQ-ZKEVEFCSSA-N.
| Molecular formula | C18H32O2 |
|---|---|
| Molecular weight | 285.5 g/mol |
| IUPAC name | (9E,12E)-17,17,18,18,18-pentadeuteriooctadeca-9,12-dienoic acid |
| InChIKey | OYHQOLUKZRVURQ-ZKEVEFCSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])CCC/C=C/C/C=C/CCCCCCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Linoleic acid-d5