CAS 1169966-62-4 is the registry number for Methyl 2-(3-aminobenzenesulfonamido)acetate hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Methyl 2-[(3-aminophenyl)sulfonylamino]acetate;hydrochloride (CAS 1169966-62-4) is a chemical compound with the molecular formula C9H13ClN2O4S and a molecular weight of 280.73 g/mol. IUPAC name: methyl 2-[(3-aminophenyl)sulfonylamino]acetate;hydrochloride. InChIKey: ZWISXNLIXZLGLE-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O4S |
|---|---|
| Molecular weight | 280.73 g/mol |
| IUPAC name | methyl 2-[(3-aminophenyl)sulfonylamino]acetate;hydrochloride |
| InChIKey | ZWISXNLIXZLGLE-UHFFFAOYSA-N |
| SMILES | COC(=O)CNS(=O)(=O)C1=CC=CC(=C1)N.Cl |
Computed by PubChem (NCBI)