Products 1169966-62-4

CAS 1169966-62-4 is the registry number for Methyl 2-(3-aminobenzenesulfonamido)acetate hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-[(3-aminophenyl)sulfonylamino]acetate;hydrochloride (CAS 1169966-62-4) is a chemical compound with the molecular formula C9H13ClN2O4S and a molecular weight of 280.73 g/mol. IUPAC name: methyl 2-[(3-aminophenyl)sulfonylamino]acetate;hydrochloride. InChIKey: ZWISXNLIXZLGLE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13ClN2O4S
Molecular weight280.73 g/mol
IUPAC namemethyl 2-[(3-aminophenyl)sulfonylamino]acetate;hydrochloride
InChIKeyZWISXNLIXZLGLE-UHFFFAOYSA-N
SMILESCOC(=O)CNS(=O)(=O)C1=CC=CC(=C1)N.Cl

Computed by PubChem (NCBI)