Products 116998-09-5

CAS 116998-09-5 is the registry number for Phthalic acid, n-dodecyl-n-undecyl ester. Offered by: Dr. Ehrenstorfer. Available pack sizes: 50mg.

Structural formula: {0} (CAS {1})

2-(carboxymethylamino)-2-oxoacetic acid (CAS 116998-09-5) is a chemical compound with the molecular formula C4H5NO5 and a molecular weight of 147.09 g/mol. IUPAC name: 2-(carboxymethylamino)-2-oxoacetic acid. InChIKey: BIMZLRFONYSTPT-UHFFFAOYSA-N.

Identity
Molecular formulaC4H5NO5
Molecular weight147.09 g/mol
IUPAC name2-(carboxymethylamino)-2-oxoacetic acid
InChIKeyBIMZLRFONYSTPT-UHFFFAOYSA-N
SMILESC(C(=O)O)NC(=O)C(=O)O

Computed by PubChem (NCBI)