CAS 1170034-47-5 appears in our catalog under these names: 4-(4-Fluorophenyl)-4H,5H,6H,7H-thieno(3,2-c)pyridine, 95%, 4-(4-fluorophenyl)-4H,5H,6H,7H-thieno[3,2-c]pyridine, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g, 10g.
4-(4-fluorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine (CAS 1170034-47-5) is a chemical compound with the molecular formula C13H12FNS and a molecular weight of 233.31 g/mol. IUPAC name: 4-(4-fluorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine. InChIKey: LJRZKBCXVFASGK-UHFFFAOYSA-N.
| Molecular formula | C13H12FNS |
|---|---|
| Molecular weight | 233.31 g/mol |
| IUPAC name | 4-(4-fluorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine |
| InChIKey | LJRZKBCXVFASGK-UHFFFAOYSA-N |
| SMILES | C1CNC(C2=C1SC=C2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)