CAS 1170048-72-2 is the registry number for 4-(4-Fluorobenzenesulfonyl)aniline hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-(4-fluorophenyl)sulfonylaniline;hydrochloride (CAS 1170048-72-2) is a chemical compound with the molecular formula C12H11ClFNO2S and a molecular weight of 287.74 g/mol. IUPAC name: 4-(4-fluorophenyl)sulfonylaniline;hydrochloride. InChIKey: DACVRMFEOFGBEQ-UHFFFAOYSA-N.
| Molecular formula | C12H11ClFNO2S |
|---|---|
| Molecular weight | 287.74 g/mol |
| IUPAC name | 4-(4-fluorophenyl)sulfonylaniline;hydrochloride |
| InChIKey | DACVRMFEOFGBEQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)