CAS 1170114-45-0 appears in our catalog under these names: Potassium 3-piperazin-1-ylpropanoate, 95%, Potassium 3-piperazin-1-ylpropanoate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g.
Potassium 3-piperazin-1-ylpropanoate (CAS 1170114-45-0) is a chemical compound with the molecular formula C7H13KN2O2 and a molecular weight of 196.29 g/mol. IUPAC name: potassium 3-piperazin-1-ylpropanoate. InChIKey: JXRMHYVTEKVPKN-UHFFFAOYSA-M.
| Molecular formula | C7H13KN2O2 |
|---|---|
| Molecular weight | 196.29 g/mol |
| IUPAC name | potassium 3-piperazin-1-ylpropanoate |
| InChIKey | JXRMHYVTEKVPKN-UHFFFAOYSA-M |
| SMILES | C1CN(CCN1)CCC(=O)[O-].[K+] |
Computed by PubChem (NCBI)