CAS 1170221-91-6 is the registry number for 1-(5-Bromopyridin-2-yl)piperazine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g.
1-(5-bromo-2-pyridinyl)piperazine;dihydrochloride (CAS 1170221-91-6) is a chemical compound with the molecular formula C9H14BrCl2N3 and a molecular weight of 315.03 g/mol. IUPAC name: 1-(5-bromo-2-pyridinyl)piperazine;dihydrochloride. InChIKey: LBVFHBCPACAANM-UHFFFAOYSA-N.
| Molecular formula | C9H14BrCl2N3 |
|---|---|
| Molecular weight | 315.03 g/mol |
| IUPAC name | 1-(5-bromo-2-pyridinyl)piperazine;dihydrochloride |
| InChIKey | LBVFHBCPACAANM-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC=C(C=C2)Br.Cl.Cl |
Computed by PubChem (NCBI)