Products 1170221-91-6

CAS 1170221-91-6 is the registry number for 1-(5-Bromopyridin-2-yl)piperazine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g.

Structural formula: {0} (CAS {1})

1-(5-bromo-2-pyridinyl)piperazine;dihydrochloride (CAS 1170221-91-6) is a chemical compound with the molecular formula C9H14BrCl2N3 and a molecular weight of 315.03 g/mol. IUPAC name: 1-(5-bromo-2-pyridinyl)piperazine;dihydrochloride. InChIKey: LBVFHBCPACAANM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14BrCl2N3
Molecular weight315.03 g/mol
IUPAC name1-(5-bromo-2-pyridinyl)piperazine;dihydrochloride
InChIKeyLBVFHBCPACAANM-UHFFFAOYSA-N
SMILESC1CN(CCN1)C2=NC=C(C=C2)Br.Cl.Cl

Computed by PubChem (NCBI)