CAS 117027-34-6 appears in our catalog under these names: (D–Pro¹⁹⁴)–IL–1β (193–195) (human), (D-Pro194)-IL-1beta (193-195) (human), Lys-D-Pro-Thr, 99%, 99%, Lys-D-Pro-Thr, 99.63%. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 25mg, 50mg, 5mg, 10mg, 10 mg, 5 mg.
(2S,3R)-2-[[(2R)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonyl]amino]-3-hydroxybutanoic acid (CAS 117027-34-6) is a chemical compound with the molecular formula C15H28N4O5 and a molecular weight of 344.41 g/mol. IUPAC name: (2S,3R)-2-[[(2R)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonyl]amino]-3-hydroxybutanoic acid. InChIKey: LOGFVTREOLYCPF-KXNHARMFSA-N.
| Molecular formula | C15H28N4O5 |
|---|---|
| Molecular weight | 344.41 g/mol |
| IUPAC name | (2S,3R)-2-[[(2R)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonyl]amino]-3-hydroxybutanoic acid |
| InChIKey | LOGFVTREOLYCPF-KXNHARMFSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)[C@H]1CCCN1C(=O)[C@H](CCCCN)N)O |
Computed by PubChem (NCBI)