CAS 1170432-25-3 is the registry number for 4-(1-Benzyl-2,5-dimethyl-1H-pyrrol-3-yl)-1,3-thiazol-2-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-(1-benzyl-2,5-dimethylpyrrol-3-yl)-1,3-thiazol-2-amine;hydrochloride (CAS 1170432-25-3) is a chemical compound with the molecular formula C16H18ClN3S and a molecular weight of 319.9 g/mol. IUPAC name: 4-(1-benzyl-2,5-dimethylpyrrol-3-yl)-1,3-thiazol-2-amine;hydrochloride. InChIKey: YBNCXSBJGQVORN-UHFFFAOYSA-N.
| Molecular formula | C16H18ClN3S |
|---|---|
| Molecular weight | 319.9 g/mol |
| IUPAC name | 4-(1-benzyl-2,5-dimethylpyrrol-3-yl)-1,3-thiazol-2-amine;hydrochloride |
| InChIKey | YBNCXSBJGQVORN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1CC2=CC=CC=C2)C)C3=CSC(=N3)N.Cl |
Computed by PubChem (NCBI)