CAS 1170461-72-9 appears in our catalog under these names: 6-Amino-2-azaspiro[3.3]heptane-6-carboxylic acid dihydrochloride, 95%, 6-Amino-2-azaspiro(3.3)heptane-6-carboxylic acid dihydrochloride, 98+%, 6–Amino–2–azaspiro(3·3)heptane–6–carboxylic acid dihydrochloride, 6-amino-2-azaspiro(3.3)heptane-6-carboxylic acid dihydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 5g, 0,5g, 50mg.
6-amino-2-azaspiro[3.3]heptane-6-carboxylic acid;dihydrochloride (CAS 1170461-72-9) is a chemical compound with the molecular formula C7H14Cl2N2O2 and a molecular weight of 229.10 g/mol. IUPAC name: 6-amino-2-azaspiro[3.3]heptane-6-carboxylic acid;dihydrochloride. InChIKey: YCBXZTYTMSDKJN-UHFFFAOYSA-N.
| Molecular formula | C7H14Cl2N2O2 |
|---|---|
| Molecular weight | 229.10 g/mol |
| IUPAC name | 6-amino-2-azaspiro[3.3]heptane-6-carboxylic acid;dihydrochloride |
| InChIKey | YCBXZTYTMSDKJN-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C(=O)O)N)CNC2.Cl.Cl |
Computed by PubChem (NCBI)