CAS 1170573-62-2 is the registry number for 5-(1H-Pyrrol-1-yl)-1-(3-(trifluoromethyl)phenyl)-1H-pyrazole-4-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-pyrrol-1-yl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxylic acid (CAS 1170573-62-2) is a chemical compound with the molecular formula C15H10F3N3O2 and a molecular weight of 321.25 g/mol. IUPAC name: 5-pyrrol-1-yl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxylic acid. InChIKey: YURSYSHAUGRDQJ-UHFFFAOYSA-N.
| Molecular formula | C15H10F3N3O2 |
|---|---|
| Molecular weight | 321.25 g/mol |
| IUPAC name | 5-pyrrol-1-yl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxylic acid |
| InChIKey | YURSYSHAUGRDQJ-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=C(C=NN2C3=CC=CC(=C3)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)