CAS 1170599-99-1 is the registry number for 3-(4-Nitrophenyl)imidazo(1,5-a)pyrazin-1-ol hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-(4-nitrophenyl)imidazo[1,5-a]pyrazin-1-ol;hydrochloride (CAS 1170599-99-1) is a chemical compound with the molecular formula C12H9ClN4O3 and a molecular weight of 292.68 g/mol. IUPAC name: 3-(4-nitrophenyl)imidazo[1,5-a]pyrazin-1-ol;hydrochloride. InChIKey: XJTYBVZEFNKXLF-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN4O3 |
|---|---|
| Molecular weight | 292.68 g/mol |
| IUPAC name | 3-(4-nitrophenyl)imidazo[1,5-a]pyrazin-1-ol;hydrochloride |
| InChIKey | XJTYBVZEFNKXLF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=C3N2C=CN=C3)O)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)