CAS 1170652-14-8 is the registry number for 1-(2,6-Difluorobenzenesulfonyl)piperazine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(2,6-difluorophenyl)sulfonylpiperazine;hydrochloride (CAS 1170652-14-8) is a chemical compound with the molecular formula C10H13ClF2N2O2S and a molecular weight of 298.74 g/mol. IUPAC name: 1-(2,6-difluorophenyl)sulfonylpiperazine;hydrochloride. InChIKey: ZWERRKCLGIVZHZ-UHFFFAOYSA-N.
| Molecular formula | C10H13ClF2N2O2S |
|---|---|
| Molecular weight | 298.74 g/mol |
| IUPAC name | 1-(2,6-difluorophenyl)sulfonylpiperazine;hydrochloride |
| InChIKey | ZWERRKCLGIVZHZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)C2=C(C=CC=C2F)F.Cl |
Computed by PubChem (NCBI)