CAS 117066-77-0 is the registry number for epi-gamma-Eudesmol. Offered by: TRC. Available pack sizes: 25mg, 100mg.
2-[(2S,4aR)-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propan-2-ol (CAS 117066-77-0) is a chemical compound with the molecular formula C15H26O and a molecular weight of 222.37 g/mol. IUPAC name: 2-[(2S,4aR)-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propan-2-ol. InChIKey: WMOPMQRJLLIEJV-SWLSCSKDSA-N.
| Molecular formula | C15H26O |
|---|---|
| Molecular weight | 222.37 g/mol |
| IUPAC name | 2-[(2S,4aR)-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propan-2-ol |
| InChIKey | WMOPMQRJLLIEJV-SWLSCSKDSA-N |
| SMILES | CC1=C2C[C@H](CC[C@]2(CCC1)C)C(C)(C)O |
Computed by PubChem (NCBI)