CAS 1170797-45-1 is the registry number for (1-(Pyridin-2-yl)cyclohexyl)methanamine, tosylatesalt, 95%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
4-methylbenzenesulfonic acid;(1-pyridin-2-ylcyclohexyl)methanamine (CAS 1170797-45-1) is a chemical compound with the molecular formula C19H26N2O3S and a molecular weight of 362.5 g/mol. IUPAC name: 4-methylbenzenesulfonic acid;(1-pyridin-2-ylcyclohexyl)methanamine. InChIKey: BMCAWYPTXBFSOF-UHFFFAOYSA-N.
| Molecular formula | C19H26N2O3S |
|---|---|
| Molecular weight | 362.5 g/mol |
| IUPAC name | 4-methylbenzenesulfonic acid;(1-pyridin-2-ylcyclohexyl)methanamine |
| InChIKey | BMCAWYPTXBFSOF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1CCC(CC1)(CN)C2=CC=CC=N2 |
Computed by PubChem (NCBI)