CAS 1170915-85-1 is the registry number for 4-Methyl-5-(piperazine-1-sulfonyl)-2,3-dihydro-1,3-thiazol-2-one hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-methyl-5-piperazin-1-ylsulfonyl-3H-1,3-thiazol-2-one;hydrochloride (CAS 1170915-85-1) is a chemical compound with the molecular formula C8H14ClN3O3S2 and a molecular weight of 299.8 g/mol. IUPAC name: 4-methyl-5-piperazin-1-ylsulfonyl-3H-1,3-thiazol-2-one;hydrochloride. InChIKey: VYGGGPUTBQXMBT-UHFFFAOYSA-N.
| Molecular formula | C8H14ClN3O3S2 |
|---|---|
| Molecular weight | 299.8 g/mol |
| IUPAC name | 4-methyl-5-piperazin-1-ylsulfonyl-3H-1,3-thiazol-2-one;hydrochloride |
| InChIKey | VYGGGPUTBQXMBT-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=O)N1)S(=O)(=O)N2CCNCC2.Cl |
Computed by PubChem (NCBI)