CAS 1170979-24-4 is the registry number for 2-(4-(Chloromethyl)-1,3-thiazol-2-yl)-N,N-dimethylacetamide hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-dimethylacetamide;hydrochloride (CAS 1170979-24-4) is a chemical compound with the molecular formula C8H12Cl2N2OS and a molecular weight of 255.16 g/mol. IUPAC name: 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-dimethylacetamide;hydrochloride. InChIKey: MNOBOIONDKDYFC-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N2OS |
|---|---|
| Molecular weight | 255.16 g/mol |
| IUPAC name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-dimethylacetamide;hydrochloride |
| InChIKey | MNOBOIONDKDYFC-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)CC1=NC(=CS1)CCl.Cl |
Computed by PubChem (NCBI)