CAS 1171123-46-8 appears in our catalog under these names: EMD 386088 Hydrochloride, EMD386088, 98+%, EMD 386088 hydrochloride, EMD386088, EMD386088, 99%, 99%. Offered by: TRC, AmBeed, TargetMol, GLPBio, Biosynth. Available pack sizes: 100mg, 50mg, 10mg, 25mg, 5mg, 25 mg, 10mM/1mL, 5 mg.
5-chloro-2-methyl-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole;hydrochloride (CAS 1171123-46-8) is a chemical compound with the molecular formula C14H16Cl2N2 and a molecular weight of 283.2 g/mol. IUPAC name: 5-chloro-2-methyl-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole;hydrochloride. InChIKey: WWSNDUWIZDYGIQ-UHFFFAOYSA-N.
| Molecular formula | C14H16Cl2N2 |
|---|---|
| Molecular weight | 283.2 g/mol |
| IUPAC name | 5-chloro-2-methyl-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole;hydrochloride |
| InChIKey | WWSNDUWIZDYGIQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C=CC(=C2)Cl)C3=CCNCC3.Cl |
Computed by PubChem (NCBI)