CAS 117142-26-4 appears in our catalog under these names: Boc–Ala(3–pyridyl)–OH, Boc-L-3Pal-OH, BOC-3-(3-PYRIDYL)-ALA-OH, >=99.0%, Boc-L-3-(3-pyridyl)-alanine, 98%, 98%, Boc-3-Pal-OH, 99.56%. Offered by: GLPBio, Iris Biotech, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 25g, 5g, 1G, 250mg, 250g, 10g, 50g, 100g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridin-3-ylpropanoic acid (CAS 117142-26-4) is a chemical compound with the molecular formula C13H18N2O4 and a molecular weight of 266.29 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridin-3-ylpropanoic acid. InChIKey: JLBCSWWZSSVXRQ-JTQLQIEISA-N.
| Molecular formula | C13H18N2O4 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridin-3-ylpropanoic acid |
| InChIKey | JLBCSWWZSSVXRQ-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CN=CC=C1)C(=O)O |
Computed by PubChem (NCBI)