CAS 1171438-47-3 is the registry number for N1,N1-Dimethyl-3-(trifluoromethyl)benzene-1,4-diamine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-N,4-N-dimethyl-2-(trifluoromethyl)benzene-1,4-diamine;hydrochloride (CAS 1171438-47-3) is a chemical compound with the molecular formula C9H12ClF3N2 and a molecular weight of 240.65 g/mol. IUPAC name: 4-N,4-N-dimethyl-2-(trifluoromethyl)benzene-1,4-diamine;hydrochloride. InChIKey: SBXKNCLWNJWTSG-UHFFFAOYSA-N.
| Molecular formula | C9H12ClF3N2 |
|---|---|
| Molecular weight | 240.65 g/mol |
| IUPAC name | 4-N,4-N-dimethyl-2-(trifluoromethyl)benzene-1,4-diamine;hydrochloride |
| InChIKey | SBXKNCLWNJWTSG-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=C(C=C1)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)