Products 1171461-61-2

CAS 1171461-61-2 is the registry number for 5-Bromo-4-chloro-3-indolyl phenyl phosphate, p-toluidine salt, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.

Structural formula: {0} (CAS {1})

(5-bromo-4-chloro-1H-indol-3-yl)oxy-phenylphosphinic acid;4-methylaniline (CAS 1171461-61-2) is a chemical compound with the molecular formula C21H19BrClN2O3P and a molecular weight of 493.7 g/mol. IUPAC name: (5-bromo-4-chloro-1H-indol-3-yl)oxy-phenylphosphinic acid;4-methylaniline. InChIKey: VKKDUVHURWUNSC-UHFFFAOYSA-N.

Identity
Molecular formulaC21H19BrClN2O3P
Molecular weight493.7 g/mol
IUPAC name(5-bromo-4-chloro-1H-indol-3-yl)oxy-phenylphosphinic acid;4-methylaniline
InChIKeyVKKDUVHURWUNSC-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)N.C1=CC=C(C=C1)P(=O)(O)OC2=CNC3=C2C(=C(C=C3)Br)Cl

Computed by PubChem (NCBI)