CAS 1171461-61-2 is the registry number for 5-Bromo-4-chloro-3-indolyl phenyl phosphate, p-toluidine salt, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
(5-bromo-4-chloro-1H-indol-3-yl)oxy-phenylphosphinic acid;4-methylaniline (CAS 1171461-61-2) is a chemical compound with the molecular formula C21H19BrClN2O3P and a molecular weight of 493.7 g/mol. IUPAC name: (5-bromo-4-chloro-1H-indol-3-yl)oxy-phenylphosphinic acid;4-methylaniline. InChIKey: VKKDUVHURWUNSC-UHFFFAOYSA-N.
| Molecular formula | C21H19BrClN2O3P |
|---|---|
| Molecular weight | 493.7 g/mol |
| IUPAC name | (5-bromo-4-chloro-1H-indol-3-yl)oxy-phenylphosphinic acid;4-methylaniline |
| InChIKey | VKKDUVHURWUNSC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N.C1=CC=C(C=C1)P(=O)(O)OC2=CNC3=C2C(=C(C=C3)Br)Cl |
Computed by PubChem (NCBI)