Products 117152-72-4

CAS 117152-72-4 is the registry number for Plerixafor Impurity 7. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1,8-bis-(4-methylphenyl)sulfonyl-1,4,8,11-tetrazacyclotetradecane (CAS 117152-72-4) is a chemical compound with the molecular formula C24H36N4O4S2 and a molecular weight of 508.7 g/mol. IUPAC name: 1,8-bis-(4-methylphenyl)sulfonyl-1,4,8,11-tetrazacyclotetradecane. InChIKey: CBORVMMMGJGEBU-UHFFFAOYSA-N.

Identity
Molecular formulaC24H36N4O4S2
Molecular weight508.7 g/mol
IUPAC name1,8-bis-(4-methylphenyl)sulfonyl-1,4,8,11-tetrazacyclotetradecane
InChIKeyCBORVMMMGJGEBU-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)N2CCCNCCN(CCCNCC2)S(=O)(=O)C3=CC=C(C=C3)C

Computed by PubChem (NCBI)