Products 1171571-17-7

CAS 1171571-17-7 is the registry number for 4-(1H-Imidazol-1-yl)-3-nitrobenzoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g.

Structural formula: {0} (CAS {1})

4-imidazol-1-yl-3-nitrobenzoic acid;hydrochloride (CAS 1171571-17-7) is a chemical compound with the molecular formula C10H8ClN3O4 and a molecular weight of 269.64 g/mol. IUPAC name: 4-imidazol-1-yl-3-nitrobenzoic acid;hydrochloride. InChIKey: ZDNPZXIUINEQGF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8ClN3O4
Molecular weight269.64 g/mol
IUPAC name4-imidazol-1-yl-3-nitrobenzoic acid;hydrochloride
InChIKeyZDNPZXIUINEQGF-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])N2C=CN=C2.Cl

Computed by PubChem (NCBI)