CAS 1171671-50-3 is the registry number for 6-Chloro-3,4-dihydro-2H-1,4-benzothiazine hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
6-chloro-3,4-dihydro-2H-1,4-benzothiazine;hydrochloride (CAS 1171671-50-3) is a chemical compound with the molecular formula C8H9Cl2NS and a molecular weight of 222.13 g/mol. IUPAC name: 6-chloro-3,4-dihydro-2H-1,4-benzothiazine;hydrochloride. InChIKey: OOJBUHJOKLKEFY-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NS |
|---|---|
| Molecular weight | 222.13 g/mol |
| IUPAC name | 6-chloro-3,4-dihydro-2H-1,4-benzothiazine;hydrochloride |
| InChIKey | OOJBUHJOKLKEFY-UHFFFAOYSA-N |
| SMILES | C1CSC2=C(N1)C=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)