CAS 1171742-97-4 appears in our catalog under these names: 2-(3,5-Dichlorophenyl) morpholine oxalate, 95%, 2-(3,5-Dichlorophenyl)morpholine oxalate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-(3,5-dichlorophenyl)morpholine;oxalic acid (CAS 1171742-97-4) is a chemical compound with the molecular formula C12H13Cl2NO5 and a molecular weight of 322.14 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)morpholine;oxalic acid. InChIKey: SCMJVEVHDSRJCV-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl2NO5 |
|---|---|
| Molecular weight | 322.14 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)morpholine;oxalic acid |
| InChIKey | SCMJVEVHDSRJCV-UHFFFAOYSA-N |
| SMILES | C1COC(CN1)C2=CC(=CC(=C2)Cl)Cl.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)