CAS 1171822-48-2 is the registry number for 3–Sulfo–2–pyridinecarboxylic acid 2–methyl ester. Offered by: GLPBio. Available pack sizes: 250mg.
2-methoxycarbonylpyridine-3-sulfonic acid (CAS 1171822-48-2) is a chemical compound with the molecular formula C7H7NO5S and a molecular weight of 217.20 g/mol. IUPAC name: 2-methoxycarbonylpyridine-3-sulfonic acid. InChIKey: ADFSDNGUJLSNBO-UHFFFAOYSA-N.
| Molecular formula | C7H7NO5S |
|---|---|
| Molecular weight | 217.20 g/mol |
| IUPAC name | 2-methoxycarbonylpyridine-3-sulfonic acid |
| InChIKey | ADFSDNGUJLSNBO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC=N1)S(=O)(=O)O |
Computed by PubChem (NCBI)