Products 1171838-47-3
CAS 1171838-47-3 is the registry number for 6-(1-Ethyl-1H-pyrazol-3-yl)-1,3-dimethyl-1H-pyrazolo(3,4-b)pyridine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-(1-ethylpyrazol-3-yl)-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxylic acid (CAS 1171838-47-3) is a chemical compound with the molecular formula C14H15N5O2 and a molecular weight of 285.30 g/mol. IUPAC name: 6-(1-ethylpyrazol-3-yl)-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxylic acid. InChIKey: SHBWYJFZQVVGIQ-UHFFFAOYSA-N.
| Molecular formula | C14H15N5O2 |
|---|---|
| Molecular weight | 285.30 g/mol |
| IUPAC name | 6-(1-ethylpyrazol-3-yl)-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxylic acid |
| InChIKey | SHBWYJFZQVVGIQ-UHFFFAOYSA-N |
| SMILES | CCN1C=CC(=N1)C2=NC3=C(C(=NN3C)C)C(=C2)C(=O)O |
Computed by PubChem (NCBI)