CAS 1171848-55-7 is the registry number for 1,3-Dimethyl-6-(1-methyl-1H-pyrazol-4-yl)-1H-pyrazolo(3,4-b)pyridine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1,3-dimethyl-6-(1-methylpyrazol-4-yl)pyrazolo[5,4-b]pyridine-4-carboxylic acid (CAS 1171848-55-7) is a chemical compound with the molecular formula C13H13N5O2 and a molecular weight of 271.27 g/mol. IUPAC name: 1,3-dimethyl-6-(1-methylpyrazol-4-yl)pyrazolo[5,4-b]pyridine-4-carboxylic acid. InChIKey: SYGGINSAINJSHE-UHFFFAOYSA-N.
| Molecular formula | C13H13N5O2 |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | 1,3-dimethyl-6-(1-methylpyrazol-4-yl)pyrazolo[5,4-b]pyridine-4-carboxylic acid |
| InChIKey | SYGGINSAINJSHE-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=CC(=N2)C3=CN(N=C3)C)C(=O)O)C |
Computed by PubChem (NCBI)